C64H68N4O — CID 165374983
CID 165374983 (PubChem CID 165374983) has the molecular formula C64H68N4O and a molecular weight of 909.27 g/mol.
| Compound Name | CID 165374983 |
|---|---|
| PubChem CID | 165374983 |
| Molecular Formula | C64H68N4O |
| Molecular Weight | 909.27 g/mol |
| Exact Mass | 908.54 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n2c3c(cccc31)C1(c3ccc(Oc4ccc5c6cccc(C(C)(C)C)c6n(-c6ccccn6)c5c4)cc3-2)c2c(cc(C(C)(C)C)cc2C(C)(C)C)-c2cc(C(C)(C)C)cc(C(C)(C)C)c21 |
| InChI | InChI=1S/C64H68N4O/c1-59(2,3)38-31-44-45-32-39(60(4,5)6)34-50(63(13,14)15)56(45)64(55(44)49(33-38)62(10,11)12)46-29-27-41(36-53(46)67-37-66(16)51-24-20-23-48(64)58(51)67)69-40-26-28-42-43-21-19-22-47(61(7,8)9)57(43)68(52(42)35-40)54-25-17-18-30-65-54/h17-36H,1-16H3 |
| InChIKey | WWCGHEJRYAEUMQ-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.27 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|