About CID 165375107
CID 165375107 (PubChem CID 165375107) has the molecular formula C46H26N6OS
and a molecular weight of 710.82 g/mol.
Molecular Properties
| Compound Name | CID 165375107 |
| PubChem CID | 165375107 |
| Molecular Formula | C46H26N6OS |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n2c3c(cccc31)C1(c3cc(C#N)ccc3Sc3ccc(C#N)cc31)c1ccc(Oc3ccc4c5ccccc5n(-c5ccccn5)c4c3)cc1-2 |
| InChI | InChI=1S/C46H26N6OS/c1-50-27-51-41-24-31(53-30-14-16-33-32-7-2-3-9-38(32)52(40(33)23-30)44-11-4-5-20-49-44)15-17-34(41)46(35-8-6-10-39(50)45(35)51)36-21-28(25-47)12-18-42(36)54-43-19-13-29(26-48)22-37(43)46/h2-24H,1H3 |
| InChIKey | FDVYAWWCFXPIHG-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 83.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165375107 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165375107?
The IUPAC name of CID 165375107 (CID 165375107) is not available.
What is the SMILES notation for CID 165375107?
The canonical SMILES for CID 165375107 is C[n+]1[c-]n2c3c(cccc31)C1(c3cc(C#N)ccc3Sc3ccc(C#N)cc31)c1ccc(Oc3ccc4c5ccccc5n(-c5ccccn5)c4c3)cc1-2.
What is the InChIKey of CID 165375107?
The InChIKey is FDVYAWWCFXPIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H26N6OS/c1-50-27-51-41-24-31(53-30-14-16-33-32-7-2-3-9-38(32)52(40(33)23-30)44-11-4-5-20-49-44)15-17-34(41)46(35-8-6-10-39(50)45(35)51)36-21-28(25-47)12-18-42(36)54-43-19-13-29(26-48)22-37(43)46/h2-24H,1H3.
What are the key properties of CID 165375107?
CID 165375107 has a molecular weight of 710.82 g/mol, XLogP of 9.44, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165375107 is sourced from PubChem (CID 165375107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).