About CID 165375085
CID 165375085 (PubChem CID 165375085) has the molecular formula C59H59N5O
and a molecular weight of 854.15 g/mol.
Molecular Properties
| Compound Name | CID 165375085 |
| PubChem CID | 165375085 |
| Molecular Formula | C59H59N5O |
| Molecular Weight | 854.15 g/mol |
| Exact Mass | 853.47 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n2c3c(cccc31)C1(c3ccc(Oc4ccc5c6ncccc6n(-c6ccccn6)c5c4)cc3-2)c2c(cc(C(C)(C)C)cc2C(C)(C)C)-c2cc(C(C)(C)C)cc(C(C)(C)C)c21 |
| InChI | InChI=1S/C59H59N5O/c1-55(2,3)35-28-40-41-29-36(56(4,5)6)31-45(58(10,11)12)52(41)59(51(40)44(30-35)57(7,8)9)42-25-23-38(33-49(42)63-34-62(13)47-19-16-18-43(59)54(47)63)65-37-22-24-39-48(32-37)64(50-21-14-15-26-60-50)46-20-17-27-61-53(39)46/h14-33H,1-13H3 |
| InChIKey | SEHCNBCEMDYLHQ-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 854.15 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165375085 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165375085?
The IUPAC name of CID 165375085 (CID 165375085) is not available.
What is the SMILES notation for CID 165375085?
The canonical SMILES for CID 165375085 is C[n+]1[c-]n2c3c(cccc31)C1(c3ccc(Oc4ccc5c6ncccc6n(-c6ccccn6)c5c4)cc3-2)c2c(cc(C(C)(C)C)cc2C(C)(C)C)-c2cc(C(C)(C)C)cc(C(C)(C)C)c21.
What is the InChIKey of CID 165375085?
The InChIKey is SEHCNBCEMDYLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C59H59N5O/c1-55(2,3)35-28-40-41-29-36(56(4,5)6)31-45(58(10,11)12)52(41)59(51(40)44(30-35)57(7,8)9)42-25-23-38(33-49(42)63-34-62(13)47-19-16-18-43(59)54(47)63)65-37-22-24-39-48(32-37)64(50-21-14-15-26-60-50)46-20-17-27-61-53(39)46/h14-33H,1-13H3.
What are the key properties of CID 165375085?
CID 165375085 has a molecular weight of 854.15 g/mol, XLogP of 13.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165375085 is sourced from PubChem (CID 165375085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).