C22H21F2N5 — CID 165380342
N-[3-(3,3-dimethylbut-1-ynyl)-5-fluorophenyl]-6-fluoro-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine (PubChem CID 165380342) has the molecular formula C22H21F2N5 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[3-(3,3-dimethylbut-1-ynyl)-5-fluorophenyl]-6-fluoro-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine.
| Compound Name | N-[3-(3,3-dimethylbut-1-ynyl)-5-fluorophenyl]-6-fluoro-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 165380342 |
| Molecular Formula | C22H21F2N5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[3-(3,3-dimethylbut-1-ynyl)-5-fluorophenyl]-6-fluoro-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2cc(F)cc(C#CC(C)(C)C)c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H21F2N5/c1-22(2,3)8-7-14-9-16(24)11-17(10-14)28(4)20-18-12-15(23)5-6-19(18)29(13-25)21(26)27-20/h5-6,9-13,25-26H,1-4H3/b25-13+,26-21+ |
| InChIKey | CFKWZGRASJPBAT-LPUPHVAQSA-N |
| XLogP | 4.41 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|