C18H19FN6 — CID 165380268
6-fluoro-2-imino-1-methanimidoyl-4-N,7-N,7-N-trimethyl-4-N-phenylquinazoline-4,7-diamine (PubChem CID 165380268) has the molecular formula C18H19FN6 and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-fluoro-2-imino-1-methanimidoyl-4-N,7-N,7-N-trimethyl-4-N-phenylquinazoline-4,7-diamine.
| Compound Name | 6-fluoro-2-imino-1-methanimidoyl-4-N,7-N,7-N-trimethyl-4-N-phenylquinazoline-4,7-diamine |
|---|---|
| PubChem CID | 165380268 |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-fluoro-2-imino-1-methanimidoyl-4-N,7-N,7-N-trimethyl-4-N-phenylquinazoline-4,7-diamine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2ccccc2)c2cc(F)c(N(C)C)cc21 |
| InChI | InChI=1S/C18H19FN6/c1-23(2)16-10-15-13(9-14(16)19)17(22-18(21)25(15)11-20)24(3)12-7-5-4-6-8-12/h4-11,20-21H,1-3H3/b20-11+,21-18+ |
| InChIKey | OXAHAXVPHYZJCT-IJYYVMIVSA-N |
| XLogP | 2.94 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|