C17H17N5O — CID 165380349
2-imino-1-methanimidoyl-8-methoxy-N-methyl-N-phenylquinazolin-4-amine (PubChem CID 165380349) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-imino-1-methanimidoyl-8-methoxy-N-methyl-N-phenylquinazolin-4-amine.
| Compound Name | 2-imino-1-methanimidoyl-8-methoxy-N-methyl-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 165380349 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-imino-1-methanimidoyl-8-methoxy-N-methyl-N-phenylquinazolin-4-amine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2ccccc2)c2cccc(OC)c21 |
| InChI | InChI=1S/C17H17N5O/c1-21(12-7-4-3-5-8-12)16-13-9-6-10-14(23-2)15(13)22(11-18)17(19)20-16/h3-11,18-19H,1-2H3/b18-11+,19-17+ |
| InChIKey | ANFQQCTZMXYUMK-HIIRIOHQSA-N |
| XLogP | 2.75 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|