C16H14BrN5 — CID 156557082
5-bromo-2-imino-1-methanimidoyl-N-methyl-N-phenylquinazolin-4-amine (PubChem CID 156557082) has the molecular formula C16H14BrN5 and a molecular weight of 356.23 g/mol. Its IUPAC name is 5-bromo-2-imino-1-methanimidoyl-N-methyl-N-phenylquinazolin-4-amine.
| Compound Name | 5-bromo-2-imino-1-methanimidoyl-N-methyl-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 156557082 |
| Molecular Formula | C16H14BrN5 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-bromo-2-imino-1-methanimidoyl-N-methyl-N-phenylquinazolin-4-amine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2ccccc2)c2c(Br)cccc21 |
| InChI | InChI=1S/C16H14BrN5/c1-21(11-6-3-2-4-7-11)15-14-12(17)8-5-9-13(14)22(10-18)16(19)20-15/h2-10,18-19H,1H3/b18-10+,19-16+ |
| InChIKey | RJNMJIVVJZSXDJ-MXVZNEBHSA-N |
| XLogP | 3.50 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|