C26H26BrN5 — CID 165380279
7-bromo-N-[3-(4-tert-butylphenyl)phenyl]-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine (PubChem CID 165380279) has the molecular formula C26H26BrN5 and a molecular weight of 488.43 g/mol. Its IUPAC name is 7-bromo-N-[3-(4-tert-butylphenyl)phenyl]-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine.
| Compound Name | 7-bromo-N-[3-(4-tert-butylphenyl)phenyl]-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 165380279 |
| Molecular Formula | C26H26BrN5 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 7-bromo-N-[3-(4-tert-butylphenyl)phenyl]-2-imino-1-methanimidoyl-N-methylquinazolin-4-amine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2cccc(-c3ccc(C(C)(C)C)cc3)c2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C26H26BrN5/c1-26(2,3)19-10-8-17(9-11-19)18-6-5-7-21(14-18)31(4)24-22-13-12-20(27)15-23(22)32(16-28)25(29)30-24/h5-16,28-29H,1-4H3/b28-16+,29-25+ |
| InChIKey | DVVWKSBVCYLAQJ-REWLUHLFSA-N |
| XLogP | 6.47 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|