C22H20N6 — CID 156800502
2-imino-1-methanimidoyl-4-N-methyl-4-N-(3-phenylphenyl)quinazoline-4,7-diamine (PubChem CID 156800502) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-imino-1-methanimidoyl-4-N-methyl-4-N-(3-phenylphenyl)quinazoline-4,7-diamine.
| Compound Name | 2-imino-1-methanimidoyl-4-N-methyl-4-N-(3-phenylphenyl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 156800502 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-imino-1-methanimidoyl-4-N-methyl-4-N-(3-phenylphenyl)quinazoline-4,7-diamine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2cccc(-c3ccccc3)c2)c2ccc(N)cc21 |
| InChI | InChI=1S/C22H20N6/c1-27(18-9-5-8-16(12-18)15-6-3-2-4-7-15)21-19-11-10-17(24)13-20(19)28(14-23)22(25)26-21/h2-14,23,25H,24H2,1H3/b23-14+,25-22+ |
| InChIKey | PDUZFOMFPPXAPH-ROXBCHIJSA-N |
| XLogP | 3.99 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|