C24H19N5 — CID 165380633
2-imino-1-methanimidoyl-N-methyl-N-phenyl-7-(2-phenylethynyl)quinazolin-4-amine (PubChem CID 165380633) has the molecular formula C24H19N5 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-imino-1-methanimidoyl-N-methyl-N-phenyl-7-(2-phenylethynyl)quinazolin-4-amine.
| Compound Name | 2-imino-1-methanimidoyl-N-methyl-N-phenyl-7-(2-phenylethynyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 165380633 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-imino-1-methanimidoyl-N-methyl-N-phenyl-7-(2-phenylethynyl)quinazolin-4-amine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N(C)c2ccccc2)c2ccc(C#Cc3ccccc3)cc21 |
| InChI | InChI=1S/C24H19N5/c1-28(20-10-6-3-7-11-20)23-21-15-14-19(13-12-18-8-4-2-5-9-18)16-22(21)29(17-25)24(26)27-23/h2-11,14-17,25-26H,1H3/b25-17+,26-24+ |
| InChIKey | FZEFZMUWJBDIHO-RUKUNDOWSA-N |
| XLogP | 4.14 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|