C38H37N5+2 — CID 165384568
5-tert-butyl-13-methyl-16-(3-methylimidazol-3-ium-1-yl)-13-[3-(3-methylimidazol-3-ium-1-yl)phenyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene (PubChem CID 165384568) has the molecular formula C38H37N5+2 and a molecular weight of 563.75 g/mol. Its IUPAC name is 5-tert-butyl-13-methyl-16-(3-methylimidazol-3-ium-1-yl)-13-[3-(3-methylimidazol-3-ium-1-yl)phenyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene.
| Compound Name | 5-tert-butyl-13-methyl-16-(3-methylimidazol-3-ium-1-yl)-13-[3-(3-methylimidazol-3-ium-1-yl)phenyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 165384568 |
| Molecular Formula | C38H37N5+2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 5-tert-butyl-13-methyl-16-(3-methylimidazol-3-ium-1-yl)-13-[3-(3-methylimidazol-3-ium-1-yl)phenyl]-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
| SMILES | C[n+]1ccn(-c2cccc(C3(C)c4cc(-n5cc[n+](C)c5)ccc4-n4c5ccc(C(C)(C)C)cc5c5cccc3c54)c2)c1 |
| InChI | InChI=1S/C38H37N5/c1-37(2,3)26-13-15-34-31(22-26)30-11-8-12-32-36(30)43(34)35-16-14-29(42-20-18-40(6)25-42)23-33(35)38(32,4)27-9-7-10-28(21-27)41-19-17-39(5)24-41/h7-25H,1-6H3/q+2 |
| InChIKey | FOSXVPDUVKPDLZ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 22.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|