C18H28N6O — CID 165385604
4-[[4-(methylamino)cyclohexyl]methoxy]-N-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 165385604) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[[4-(methylamino)cyclohexyl]methoxy]-N-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[[4-(methylamino)cyclohexyl]methoxy]-N-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 165385604 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 4-[[4-(methylamino)cyclohexyl]methoxy]-N-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CNC1CCC(COc2ccnc(Nc3cnn(C(C)C)c3)n2)CC1 |
| InChI | InChI=1S/C18H28N6O/c1-13(2)24-11-16(10-21-24)22-18-20-9-8-17(23-18)25-12-14-4-6-15(19-3)7-5-14/h8-11,13-15,19H,4-7,12H2,1-3H3,(H,20,22,23) |
| InChIKey | NZKKOFIEUDFSNX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |