C12H16N2O7 — CID 165386940
(2S)-2-[[(2S)-2-amino-3-prop-2-enoyloxypropanoyl]amino]-3-prop-2-enoyloxypropanoic acid (PubChem CID 165386940) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-prop-2-enoyloxypropanoyl]amino]-3-prop-2-enoyloxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-prop-2-enoyloxypropanoyl]amino]-3-prop-2-enoyloxypropanoic acid |
|---|---|
| PubChem CID | 165386940 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-prop-2-enoyloxypropanoyl]amino]-3-prop-2-enoyloxypropanoic acid |
| SMILES | C=CC(=O)OC[C@H](NC(=O)[C@@H](N)COC(=O)C=C)C(=O)O |
| InChI | InChI=1S/C12H16N2O7/c1-3-9(15)20-5-7(13)11(17)14-8(12(18)19)6-21-10(16)4-2/h3-4,7-8H,1-2,5-6,13H2,(H,14,17)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | YGMCIRAWOASMEZ-YUMQZZPRSA-N |
| XLogP | -1.66 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|