C14H26N+ — CID 165392059
5-methyl-1-pentan-2-yl-6-propyl-3,4-dihydropyridin-1-ium (PubChem CID 165392059) has the molecular formula C14H26N+ and a molecular weight of 208.37 g/mol. Its IUPAC name is 5-methyl-1-pentan-2-yl-6-propyl-3,4-dihydropyridin-1-ium.
| Compound Name | 5-methyl-1-pentan-2-yl-6-propyl-3,4-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 165392059 |
| Molecular Formula | C14H26N+ |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.21 |
| IUPAC Name | 5-methyl-1-pentan-2-yl-6-propyl-3,4-dihydropyridin-1-ium |
| SMILES | CCCC1=C(C)CCC=[N+]1C(C)CCC |
| InChI | InChI=1S/C14H26N/c1-5-8-13(4)15-11-7-10-12(3)14(15)9-6-2/h11,13H,5-10H2,1-4H3/q+1 |
| InChIKey | CDEZYCUUZUWOEG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|