C27H34N8O5 — CID 165395372
propyl 2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-cyanophenyl)prop-2-enyl]amino]butanoate (PubChem CID 165395372) has the molecular formula C27H34N8O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is propyl 2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-cyanophenyl)prop-2-enyl]amino]butanoate.
| Compound Name | propyl 2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-cyanophenyl)prop-2-enyl]amino]butanoate |
|---|---|
| PubChem CID | 165395372 |
| Molecular Formula | C27H34N8O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | propyl 2-amino-4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[(E)-3-(4-cyanophenyl)prop-2-enyl]amino]butanoate |
| SMILES | CCCOC(=O)C(N)CCN(C/C=C/c1ccc(C#N)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H34N8O5/c1-2-12-39-27(38)19(29)9-11-34(10-3-4-17-5-7-18(13-28)8-6-17)14-20-22(36)23(37)26(40-20)35-16-33-21-24(30)31-15-32-25(21)35/h3-8,15-16,19-20,22-23,26,36-37H,2,9-12,14,29H2,1H3,(H2,30,31,32)/b4-3+/t19?,20-,22-,23-,26-/m1/s1 |
| InChIKey | HPQNRSOILSCXPP-YYRMVWNQSA-N |
| XLogP | 0.59 |
| TPSA | 198.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |