About (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine
(3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine (PubChem CID 165403169) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine.
Analyze (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine?
The IUPAC name of (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine (CID 165403169) is (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine.
What is the SMILES notation for (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine?
The canonical SMILES for (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine is Cc1noc2cnc(CN)cc12.
What is the InChIKey of (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine?
The InChIKey is QEZBXUVTBDXHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-7-2-6(3-9)10-4-8(7)12-11-5/h2,4H,3,9H2,1H3.
What are the key properties of (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine?
(3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine has a molecular weight of 163.18 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-[1,2]oxazolo[5,4-c]pyridin-5-yl)methanamine is sourced from PubChem (CID 165403169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).