C13H22AtN3O4 — CID 165403658
[1-[6-[2-[hydroxy(methyl)amino]ethylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]astatine (PubChem CID 165403658) has the molecular formula C13H22AtN3O4 and a molecular weight of 494.34 g/mol. Its IUPAC name is [1-[6-[2-[hydroxy(methyl)amino]ethylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]astatine.
| Compound Name | [1-[6-[2-[hydroxy(methyl)amino]ethylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]astatine |
|---|---|
| PubChem CID | 165403658 |
| Molecular Formula | C13H22AtN3O4 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [1-[6-[2-[hydroxy(methyl)amino]ethylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]astatine |
| SMILES | CN(O)CCNC(=O)CCCCCN1C(=O)CC([At])C1=O |
| InChI | InChI=1S/C13H22AtN3O4/c1-16(21)8-6-15-11(18)5-3-2-4-7-17-12(19)9-10(14)13(17)20/h10,21H,2-9H2,1H3,(H,15,18) |
| InChIKey | KIRSRSSNWOLGGT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|