C12H15FN4O — CID 165403888
2-fluoro-N-methyl-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide (PubChem CID 165403888) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-fluoro-N-methyl-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide.
| Compound Name | 2-fluoro-N-methyl-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
|---|---|
| PubChem CID | 165403888 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-fluoro-N-methyl-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]benzamide |
| SMILES | CNC(=O)c1cc(/C(N)=C/C=C(N)N)ccc1F |
| InChI | InChI=1S/C12H15FN4O/c1-17-12(18)8-6-7(2-3-9(8)13)10(14)4-5-11(15)16/h2-6H,14-16H2,1H3,(H,17,18)/b10-4- |
| InChIKey | LIDFBKLXZUKEMR-WMZJFQQLSA-N |
| XLogP | 0.24 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|