C13H15F3N4O — CID 178030416
4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 178030416) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 178030416 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NC(N)=C/C=C(\N)c1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N4O/c14-13(15,16)7-20-12(21)9-3-1-8(2-4-9)10(17)5-6-11(18)19/h1-6H,7,17-19H2,(H,20,21)/b10-5- |
| InChIKey | TWMXXELDOGDEQR-YHYXMXQVSA-N |
| XLogP | 1.04 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|