C11H16F2N2O — CID 165405452
4-[(2S)-3-amino-2-(dimethylamino)propyl]-3,5-difluorophenol (PubChem CID 165405452) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-[(2S)-3-amino-2-(dimethylamino)propyl]-3,5-difluorophenol.
| Compound Name | 4-[(2S)-3-amino-2-(dimethylamino)propyl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 165405452 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-[(2S)-3-amino-2-(dimethylamino)propyl]-3,5-difluorophenol |
| SMILES | CN(C)[C@H](CN)Cc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C11H16F2N2O/c1-15(2)7(6-14)3-9-10(12)4-8(16)5-11(9)13/h4-5,7,16H,3,6,14H2,1-2H3/t7-/m0/s1 |
| InChIKey | CQLQZODMQIPZAG-ZETCQYMHSA-N |
| XLogP | 1.10 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |