C11H14FNO4 — CID 165409751
[[(1R)-8-fluoro-3,4-dihydro-1H-isochromen-1-yl]methylamino]methanetriol (PubChem CID 165409751) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is [[(1R)-8-fluoro-3,4-dihydro-1H-isochromen-1-yl]methylamino]methanetriol.
| Compound Name | [[(1R)-8-fluoro-3,4-dihydro-1H-isochromen-1-yl]methylamino]methanetriol |
|---|---|
| PubChem CID | 165409751 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [[(1R)-8-fluoro-3,4-dihydro-1H-isochromen-1-yl]methylamino]methanetriol |
| SMILES | OC(O)(O)NC[C@@H]1OCCc2cccc(F)c21 |
| InChI | InChI=1S/C11H14FNO4/c12-8-3-1-2-7-4-5-17-9(10(7)8)6-13-11(14,15)16/h1-3,9,13-16H,4-6H2/t9-/m0/s1 |
| InChIKey | DBCABWDQNCYVKR-VIFPVBQESA-N |
| XLogP | -0.38 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|