C10H12FNO — CID 175402532
(1S)-8-fluoro-N-methyl-3,4-dihydro-1H-isochromen-1-amine (PubChem CID 175402532) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (1S)-8-fluoro-N-methyl-3,4-dihydro-1H-isochromen-1-amine.
| Compound Name | (1S)-8-fluoro-N-methyl-3,4-dihydro-1H-isochromen-1-amine |
|---|---|
| PubChem CID | 175402532 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (1S)-8-fluoro-N-methyl-3,4-dihydro-1H-isochromen-1-amine |
| SMILES | CN[C@H]1OCCc2cccc(F)c21 |
| InChI | InChI=1S/C10H12FNO/c1-12-10-9-7(5-6-13-10)3-2-4-8(9)11/h2-4,10,12H,5-6H2,1H3/t10-/m0/s1 |
| InChIKey | MPLNHMVOODKGNX-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |