C10H13FN2O3S — CID 165409943
(4S)-7-fluoro-4-[methyl(sulfamoyl)amino]-3,4-dihydro-2H-chromene (PubChem CID 165409943) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is (4S)-7-fluoro-4-[methyl(sulfamoyl)amino]-3,4-dihydro-2H-chromene.
| Compound Name | (4S)-7-fluoro-4-[methyl(sulfamoyl)amino]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 165409943 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (4S)-7-fluoro-4-[methyl(sulfamoyl)amino]-3,4-dihydro-2H-chromene |
| SMILES | CN([C@H]1CCOc2cc(F)ccc21)S(N)(=O)=O |
| InChI | InChI=1S/C10H13FN2O3S/c1-13(17(12,14)15)9-4-5-16-10-6-7(11)2-3-8(9)10/h2-3,6,9H,4-5H2,1H3,(H2,12,14,15)/t9-/m0/s1 |
| InChIKey | LKOSEVXOXPTREH-VIFPVBQESA-N |
| XLogP | 0.78 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |