C14H20N2O2 — CID 165410408
N-[3-[(1Z)-buta-1,3-dienyl]-7-ethenyl-2-methyl-5H-1,4-dioxepin-6-yl]methanimine;methanamine (PubChem CID 165410408) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[3-[(1Z)-buta-1,3-dienyl]-7-ethenyl-2-methyl-5H-1,4-dioxepin-6-yl]methanimine;methanamine.
| Compound Name | N-[3-[(1Z)-buta-1,3-dienyl]-7-ethenyl-2-methyl-5H-1,4-dioxepin-6-yl]methanimine;methanamine |
|---|---|
| PubChem CID | 165410408 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-[3-[(1Z)-buta-1,3-dienyl]-7-ethenyl-2-methyl-5H-1,4-dioxepin-6-yl]methanimine;methanamine |
| SMILES | C=C/C=C\C1=C(C)OC(C=C)=C(N=C)CO1.CN |
| InChI | InChI=1S/C13H15NO2.CH5N/c1-5-7-8-13-10(3)16-12(6-2)11(14-4)9-15-13;1-2/h5-8H,1-2,4,9H2,3H3;2H2,1H3/b8-7-; |
| InChIKey | GHVZNCWSCVIRSC-CFYXSCKTSA-N |
| XLogP | 2.68 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|