C13H14N6O — CID 165414471
1-[(3R)-1-cyanopyrrolidin-3-yl]-3-imidazo[1,2-a]pyridin-2-ylurea (PubChem CID 165414471) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-[(3R)-1-cyanopyrrolidin-3-yl]-3-imidazo[1,2-a]pyridin-2-ylurea.
| Compound Name | 1-[(3R)-1-cyanopyrrolidin-3-yl]-3-imidazo[1,2-a]pyridin-2-ylurea |
|---|---|
| PubChem CID | 165414471 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[(3R)-1-cyanopyrrolidin-3-yl]-3-imidazo[1,2-a]pyridin-2-ylurea |
| SMILES | N#CN1CC[C@@H](NC(=O)Nc2cn3ccccc3n2)C1 |
| InChI | InChI=1S/C13H14N6O/c14-9-18-6-4-10(7-18)15-13(20)17-11-8-19-5-2-1-3-12(19)16-11/h1-3,5,8,10H,4,6-7H2,(H2,15,17,20)/t10-/m1/s1 |
| InChIKey | MPHTUYRHKDNUPA-SNVBAGLBSA-N |
| XLogP | 1.01 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|