About (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione
(3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione (PubChem CID 165418780) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione |
| PubChem CID | 165418780 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(Cc2cc(C3CC3)on2)[C@@H](C)C1=O |
| InChI | InChI=1S/C15H21N3O3/c1-3-6-17-9-14(19)18(10(2)15(17)20)8-12-7-13(21-16-12)11-4-5-11/h7,10-11H,3-6,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | DUKFLXGXROKVHK-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione?
The IUPAC name of (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione (CID 165418780) is (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione.
What is the SMILES notation for (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione?
The canonical SMILES for (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione is CCCN1CC(=O)N(Cc2cc(C3CC3)on2)[C@@H](C)C1=O.
What is the InChIKey of (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione?
The InChIKey is DUKFLXGXROKVHK-JTQLQIEISA-N. The full InChI is InChI=1S/C15H21N3O3/c1-3-6-17-9-14(19)18(10(2)15(17)20)8-12-7-13(21-16-12)11-4-5-11/h7,10-11H,3-6,8-9H2,1-2H3/t10-/m0/s1.
What are the key properties of (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione?
(3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione has a molecular weight of 291.35 g/mol, XLogP of 1.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-[(5-cyclopropyl-1,2-oxazol-3-yl)methyl]-3-methyl-1-propylpiperazine-2,5-dione is sourced from PubChem (CID 165418780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).