C23H34N2O — CID 165427169
[(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol (PubChem CID 165427169) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol.
| Compound Name | [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol |
|---|---|
| PubChem CID | 165427169 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol |
| SMILES | CC[C@]1(CO)C[C@H]2CC[C@@H]1N2C1CCN(c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C23H34N2O/c1-2-23(16-26)15-21-8-9-22(23)25(21)19-10-12-24(13-11-19)20-7-6-17-4-3-5-18(17)14-20/h6-7,14,19,21-22,26H,2-5,8-13,15-16H2,1H3/t21-,22+,23-/m1/s1 |
| InChIKey | OERSGZRCHADWLI-XPWALMASSA-N |
| XLogP | 3.77 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|