C21H30N2O — CID 22216210
[(1R,9S,10S,11S,12S,17S)-8,12-diethyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol (PubChem CID 22216210) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is [(1R,9S,10S,11S,12S,17S)-8,12-diethyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol.
| Compound Name | [(1R,9S,10S,11S,12S,17S)-8,12-diethyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol |
|---|---|
| PubChem CID | 22216210 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | [(1R,9S,10S,11S,12S,17S)-8,12-diethyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol |
| SMILES | CC[C@@H]1CN2CC[C@]34c5ccccc5N(CC)[C@H]3[C@@H](CO)[C@H]1C[C@H]24 |
| InChI | InChI=1S/C21H30N2O/c1-3-14-12-22-10-9-21-17-7-5-6-8-18(17)23(4-2)20(21)16(13-24)15(14)11-19(21)22/h5-8,14-16,19-20,24H,3-4,9-13H2,1-2H3/t14-,15+,16+,19+,20+,21-/m1/s1 |
| InChIKey | GDPGLZMVNLCSBR-UKULTFGTSA-N |
| XLogP | 2.88 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |