C14H17F4N3O — CID 165431838
N-[[4-fluoro-1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]methyl]acetamide (PubChem CID 165431838) has the molecular formula C14H17F4N3O and a molecular weight of 319.30 g/mol. Its IUPAC name is N-[[4-fluoro-1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[4-fluoro-1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 165431838 |
| Molecular Formula | C14H17F4N3O |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[[4-fluoro-1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1(F)CCN(c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C14H17F4N3O/c1-10(22)20-9-13(15)4-6-21(7-5-13)11-2-3-12(19-8-11)14(16,17)18/h2-3,8H,4-7,9H2,1H3,(H,20,22) |
| InChIKey | VCXUVMIGLIJYIX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |