C16H26ClNO4 — CID 165440777
2-O-tert-butyl 7-O-(chloromethyl) 8,8-dimethyl-2-azabicyclo[4.2.0]octane-2,7-dicarboxylate (PubChem CID 165440777) has the molecular formula C16H26ClNO4 and a molecular weight of 331.84 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-(chloromethyl) 8,8-dimethyl-2-azabicyclo[4.2.0]octane-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-(chloromethyl) 8,8-dimethyl-2-azabicyclo[4.2.0]octane-2,7-dicarboxylate |
|---|---|
| PubChem CID | 165440777 |
| Molecular Formula | C16H26ClNO4 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-O-tert-butyl 7-O-(chloromethyl) 8,8-dimethyl-2-azabicyclo[4.2.0]octane-2,7-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C(C(=O)OCCl)C(C)(C)C21 |
| InChI | InChI=1S/C16H26ClNO4/c1-15(2,3)22-14(20)18-8-6-7-10-11(13(19)21-9-17)16(4,5)12(10)18/h10-12H,6-9H2,1-5H3 |
| InChIKey | PIFBMUWTNMJCRX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|