C7H12F2O2 — CID 165442667
2-(4,4-difluorooxan-3-yl)ethanol (PubChem CID 165442667) has the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. Its IUPAC name is 2-(4,4-difluorooxan-3-yl)ethanol.
| Compound Name | 2-(4,4-difluorooxan-3-yl)ethanol |
|---|---|
| PubChem CID | 165442667 |
| Molecular Formula | C7H12F2O2 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2-(4,4-difluorooxan-3-yl)ethanol |
| SMILES | OCCC1COCCC1(F)F |
| InChI | InChI=1S/C7H12F2O2/c8-7(9)2-4-11-5-6(7)1-3-10/h6,10H,1-5H2 |
| InChIKey | XCOYWFOJTHMSME-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |