C6H11F2NO — CID 91602738
2-[(3R)-2,2-difluoropyrrolidin-3-yl]ethanol (PubChem CID 91602738) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-[(3R)-2,2-difluoropyrrolidin-3-yl]ethanol.
| Compound Name | 2-[(3R)-2,2-difluoropyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 91602738 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2-[(3R)-2,2-difluoropyrrolidin-3-yl]ethanol |
| SMILES | OCC[C@H]1CCNC1(F)F |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)5(2-4-10)1-3-9-6/h5,9-10H,1-4H2/t5-/m1/s1 |
| InChIKey | YEKLXMONMCVANK-RXMQYKEDSA-N |
| XLogP | 0.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|