About 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol
1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol (PubChem CID 165444812) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol |
| PubChem CID | 165444812 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol |
| SMILES | CC(O)c1cn([C@H]2CNOC2)nn1 |
| InChI | InChI=1S/C7H12N4O2/c1-5(12)7-3-11(10-9-7)6-2-8-13-4-6/h3,5-6,8,12H,2,4H2,1H3/t5?,6-/m0/s1 |
| InChIKey | QIFHEWRFTXTZCO-GDVGLLTNSA-N |
| XLogP | -0.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol?
The IUPAC name of 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol (CID 165444812) is 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol.
What is the SMILES notation for 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol?
The canonical SMILES for 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol is CC(O)c1cn([C@H]2CNOC2)nn1.
What is the InChIKey of 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol?
The InChIKey is QIFHEWRFTXTZCO-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-5(12)7-3-11(10-9-7)6-2-8-13-4-6/h3,5-6,8,12H,2,4H2,1H3/t5?,6-/m0/s1.
What are the key properties of 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol?
1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol has a molecular weight of 184.20 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(4S)-1,2-oxazolidin-4-yl]triazol-4-yl]ethanol is sourced from PubChem (CID 165444812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).