C13H14Cl2N4O3S — CID 75474688
1-[1-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]triazol-4-yl]ethanol (PubChem CID 75474688) has the molecular formula C13H14Cl2N4O3S and a molecular weight of 377.25 g/mol. Its IUPAC name is 1-[1-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 75474688 |
| Molecular Formula | C13H14Cl2N4O3S |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-[1-[1-(3,4-dichlorophenyl)sulfonylazetidin-3-yl]triazol-4-yl]ethanol |
| SMILES | CC(O)c1cn(C2CN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)C2)nn1 |
| InChI | InChI=1S/C13H14Cl2N4O3S/c1-8(20)13-7-19(17-16-13)9-5-18(6-9)23(21,22)10-2-3-11(14)12(15)4-10/h2-4,7-9,20H,5-6H2,1H3 |
| InChIKey | LVDJUBHAALUTSB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |