C9H16N4 — CID 165446837
5-methyl-3-piperidin-4-yl-1H-pyrazol-4-amine (PubChem CID 165446837) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-methyl-3-piperidin-4-yl-1H-pyrazol-4-amine.
| Compound Name | 5-methyl-3-piperidin-4-yl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 165446837 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 5-methyl-3-piperidin-4-yl-1H-pyrazol-4-amine |
| SMILES | Cc1[nH]nc(C2CCNCC2)c1N |
| InChI | InChI=1S/C9H16N4/c1-6-8(10)9(13-12-6)7-2-4-11-5-3-7/h7,11H,2-5,10H2,1H3,(H,12,13) |
| InChIKey | IOFLDBRCUOZXNV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |