C6H11NaO4S2 — CID 165449700
sodium (1,1-dioxothian-4-yl)methanesulfinate (PubChem CID 165449700) has the molecular formula C6H11NaO4S2 and a molecular weight of 234.27 g/mol. Its IUPAC name is sodium (1,1-dioxothian-4-yl)methanesulfinate.
| Compound Name | sodium (1,1-dioxothian-4-yl)methanesulfinate |
|---|---|
| PubChem CID | 165449700 |
| Molecular Formula | C6H11NaO4S2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | sodium (1,1-dioxothian-4-yl)methanesulfinate |
| SMILES | O=S([O-])CC1CCS(=O)(=O)CC1.[Na+] |
| InChI | InChI=1S/C6H12O4S2.Na/c7-11(8)5-6-1-3-12(9,10)4-2-6;/h6H,1-5H2,(H,7,8);/q;+1/p-1 |
| InChIKey | CJJLXQVKAICPGP-UHFFFAOYSA-M |
| XLogP | -3.31 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|