C8H19NO4S2 — CID 45148607
(1,1-dioxothiolan-3-yl)-trimethylazanium;methanesulfinate (PubChem CID 45148607) has the molecular formula C8H19NO4S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-trimethylazanium;methanesulfinate.
| Compound Name | (1,1-dioxothiolan-3-yl)-trimethylazanium;methanesulfinate |
|---|---|
| PubChem CID | 45148607 |
| Molecular Formula | C8H19NO4S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-trimethylazanium;methanesulfinate |
| SMILES | CS(=O)[O-].C[N+](C)(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H16NO2S.CH4O2S/c1-8(2,3)7-4-5-11(9,10)6-7;1-4(2)3/h7H,4-6H2,1-3H3;1H3,(H,2,3)/q+1;/p-1 |
| InChIKey | KMGPKYSTSOZPFS-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|