C6H2ClN2NaO3S — CID 165449892
sodium 4-chloro-2,1,3-benzoxadiazole-7-sulfinate (PubChem CID 165449892) has the molecular formula C6H2ClN2NaO3S and a molecular weight of 240.60 g/mol. Its IUPAC name is sodium 4-chloro-2,1,3-benzoxadiazole-7-sulfinate.
| Compound Name | sodium 4-chloro-2,1,3-benzoxadiazole-7-sulfinate |
|---|---|
| PubChem CID | 165449892 |
| Molecular Formula | C6H2ClN2NaO3S |
| Molecular Weight | 240.60 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | sodium 4-chloro-2,1,3-benzoxadiazole-7-sulfinate |
| SMILES | O=S([O-])c1ccc(Cl)c2nonc12.[Na+] |
| InChI | InChI=1S/C6H3ClN2O3S.Na/c7-3-1-2-4(13(10)11)6-5(3)8-12-9-6;/h1-2H,(H,10,11);/q;+1/p-1 |
| InChIKey | OVAUODXKCNMUKH-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.60 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|