C6H3ClN2O2 — CID 154108721
4-chloro-2,1,3-benzoxadiazol-7-ol (PubChem CID 154108721) has the molecular formula C6H3ClN2O2 and a molecular weight of 170.56 g/mol. Its IUPAC name is 4-chloro-2,1,3-benzoxadiazol-7-ol.
| Compound Name | 4-chloro-2,1,3-benzoxadiazol-7-ol |
|---|---|
| PubChem CID | 154108721 |
| Molecular Formula | C6H3ClN2O2 |
| Molecular Weight | 170.56 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 4-chloro-2,1,3-benzoxadiazol-7-ol |
| SMILES | Oc1ccc(Cl)c2nonc12 |
| InChI | InChI=1S/C6H3ClN2O2/c7-3-1-2-4(10)6-5(3)8-11-9-6/h1-2,10H |
| InChIKey | SMOHWBDUVQABHZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |