C11H16N2 — CID 165453352
7-ethyl-5,6,7,8-tetrahydroisoquinolin-3-amine (PubChem CID 165453352) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 7-ethyl-5,6,7,8-tetrahydroisoquinolin-3-amine.
| Compound Name | 7-ethyl-5,6,7,8-tetrahydroisoquinolin-3-amine |
|---|---|
| PubChem CID | 165453352 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 7-ethyl-5,6,7,8-tetrahydroisoquinolin-3-amine |
| SMILES | CCC1CCc2cc(N)ncc2C1 |
| InChI | InChI=1S/C11H16N2/c1-2-8-3-4-9-6-11(12)13-7-10(9)5-8/h6-8H,2-5H2,1H3,(H2,12,13) |
| InChIKey | UOLVUSZWSXEHPV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |