C14H21P — CID 143168863
2-(7-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethylphosphane (PubChem CID 143168863) has the molecular formula C14H21P and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-(7-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethylphosphane.
| Compound Name | 2-(7-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethylphosphane |
|---|---|
| PubChem CID | 143168863 |
| Molecular Formula | C14H21P |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-(7-ethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethylphosphane |
| SMILES | CCC1CCc2ccc(CCP)cc2C1 |
| InChI | InChI=1S/C14H21P/c1-2-11-3-5-13-6-4-12(7-8-15)10-14(13)9-11/h4,6,10-11H,2-3,5,7-9,15H2,1H3 |
| InChIKey | HTFBZZFTJWNSDG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|