C12H12FNO3S — CID 165459883
3-(4-propan-2-ylphenyl)-1,2-oxazole-5-sulfonyl fluoride (PubChem CID 165459883) has the molecular formula C12H12FNO3S and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-(4-propan-2-ylphenyl)-1,2-oxazole-5-sulfonyl fluoride.
| Compound Name | 3-(4-propan-2-ylphenyl)-1,2-oxazole-5-sulfonyl fluoride |
|---|---|
| PubChem CID | 165459883 |
| Molecular Formula | C12H12FNO3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-(4-propan-2-ylphenyl)-1,2-oxazole-5-sulfonyl fluoride |
| SMILES | CC(C)c1ccc(-c2cc(S(=O)(=O)F)on2)cc1 |
| InChI | InChI=1S/C12H12FNO3S/c1-8(2)9-3-5-10(6-4-9)11-7-12(17-14-11)18(13,15)16/h3-8H,1-2H3 |
| InChIKey | PVAGOIJRRKQZPW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |