About methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate
methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate (PubChem CID 165462889) has the molecular formula C10H8F2O3
and a molecular weight of 214.17 g/mol. Its IUPAC name is methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate.
Analyze methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate?
The IUPAC name of methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate (CID 165462889) is methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate.
What is the SMILES notation for methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate?
The canonical SMILES for methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate is COC(=O)C1COc2c1ccc(F)c2F.
What is the InChIKey of methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate?
The InChIKey is GUCRDMJYPMWROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O3/c1-14-10(13)6-4-15-9-5(6)2-3-7(11)8(9)12/h2-3,6H,4H2,1H3.
What are the key properties of methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate?
methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate has a molecular weight of 214.17 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6,7-difluoro-2,3-dihydro-1-benzofuran-3-carboxylate is sourced from PubChem (CID 165462889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).