C9H16FN3O2S — CID 165462993
4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 165462993) has the molecular formula C9H16FN3O2S and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride.
| Compound Name | 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 165462993 |
| Molecular Formula | C9H16FN3O2S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride |
| SMILES | CCCCn1c(CCC)nnc1S(=O)(=O)F |
| InChI | InChI=1S/C9H16FN3O2S/c1-3-5-7-13-8(6-4-2)11-12-9(13)16(10,14)15/h3-7H2,1-2H3 |
| InChIKey | KFORDZFUYAPZLC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |