4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride

C9H16FN3O2S — CID 165462993

IUPAC4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
SMILESCCCCn1c(CCC)nnc1S(=O)(=O)F
InChIInChI=1S/C9H16FN3O2S/c1-3-5-7-13-8(6-4-2)11-12-9(13)16(10,14)15/h3-7H2,1-2H3
InChIKeyKFORDZFUYAPZLC-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.69
Rot. Bonds6

About 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride

4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 165462993) has the molecular formula C9H16FN3O2S and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride.

Molecular Properties

Compound Name4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
PubChem CID165462993
Molecular FormulaC9H16FN3O2S
Molecular Weight249.31 g/mol
Exact Mass249.09
IUPAC Name4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride
SMILESCCCCn1c(CCC)nnc1S(=O)(=O)F
InChIInChI=1S/C9H16FN3O2S/c1-3-5-7-13-8(6-4-2)11-12-9(13)16(10,14)15/h3-7H2,1-2H3
InChIKeyKFORDZFUYAPZLC-UHFFFAOYSA-N
XLogP1.69
TPSA64.85 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The IUPAC name of 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride (CID 165462993) is 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride.
What is the SMILES notation for 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The canonical SMILES for 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride is CCCCn1c(CCC)nnc1S(=O)(=O)F.
What is the InChIKey of 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
The InChIKey is KFORDZFUYAPZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN3O2S/c1-3-5-7-13-8(6-4-2)11-12-9(13)16(10,14)15/h3-7H2,1-2H3.
What are the key properties of 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride?
4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride has a molecular weight of 249.31 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-propyl-1,2,4-triazole-3-sulfonyl fluoride is sourced from PubChem (CID 165462993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).