C6H8Cl3N3OS — CID 165466681
N-(2-methoxyethyl)-3-(trichloromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 165466681) has the molecular formula C6H8Cl3N3OS and a molecular weight of 276.58 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(trichloromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methoxyethyl)-3-(trichloromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 165466681 |
| Molecular Formula | C6H8Cl3N3OS |
| Molecular Weight | 276.58 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | N-(2-methoxyethyl)-3-(trichloromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCNc1nc(C(Cl)(Cl)Cl)ns1 |
| InChI | InChI=1S/C6H8Cl3N3OS/c1-13-3-2-10-5-11-4(12-14-5)6(7,8)9/h2-3H2,1H3,(H,10,11,12) |
| InChIKey | FQSJZBSZGGVFNJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|