C9H17N3OS2 — CID 65267475
N-(2-methoxyethyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65267475) has the molecular formula C9H17N3OS2 and a molecular weight of 247.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methoxyethyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65267475 |
| Molecular Formula | C9H17N3OS2 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-(2-methoxyethyl)-3-(propylsulfanylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCSCc1nsc(NCCOC)n1 |
| InChI | InChI=1S/C9H17N3OS2/c1-3-6-14-7-8-11-9(15-12-8)10-4-5-13-2/h3-7H2,1-2H3,(H,10,11,12) |
| InChIKey | VXFLDQUFSLCPEU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|