C12H21N3OS2 — CID 65268238
3-(cyclohexylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65268238) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(cyclohexylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65268238 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCNc1nc(CSC2CCCCC2)ns1 |
| InChI | InChI=1S/C12H21N3OS2/c1-16-8-7-13-12-14-11(15-18-12)9-17-10-5-3-2-4-6-10/h10H,2-9H2,1H3,(H,13,14,15) |
| InChIKey | LBGKXPBOEMWKOG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|