C11H19N3OS2 — CID 65267941
3-(cyclopentylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65267941) has the molecular formula C11H19N3OS2 and a molecular weight of 273.43 g/mol. Its IUPAC name is 3-(cyclopentylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(cyclopentylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65267941 |
| Molecular Formula | C11H19N3OS2 |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(cyclopentylsulfanylmethyl)-N-(2-methoxyethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCNc1nc(CSC2CCCC2)ns1 |
| InChI | InChI=1S/C11H19N3OS2/c1-15-7-6-12-11-13-10(14-17-11)8-16-9-4-2-3-5-9/h9H,2-8H2,1H3,(H,12,13,14) |
| InChIKey | FMFQTNJKRTVEJW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|