C6H4Cl3N3O2 — CID 165466688
4-amino-2-(trichloromethyl)pyrimidine-5-carboxylic acid (PubChem CID 165466688) has the molecular formula C6H4Cl3N3O2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 4-amino-2-(trichloromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-(trichloromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 165466688 |
| Molecular Formula | C6H4Cl3N3O2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 254.94 |
| IUPAC Name | 4-amino-2-(trichloromethyl)pyrimidine-5-carboxylic acid |
| SMILES | Nc1nc(C(Cl)(Cl)Cl)ncc1C(=O)O |
| InChI | InChI=1S/C6H4Cl3N3O2/c7-6(8,9)5-11-1-2(4(13)14)3(10)12-5/h1H,(H,13,14)(H2,10,11,12) |
| InChIKey | LHAHNVMSSDBLNE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|