C13H26N2O3S — CID 165475814
4-butylsulfonyl-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 165475814) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 4-butylsulfonyl-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 4-butylsulfonyl-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 165475814 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-butylsulfonyl-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CCCCS(=O)(=O)N1CC(C)OC2(CCNCC2)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-3-4-9-19(16,17)15-10-12(2)18-13(11-15)5-7-14-8-6-13/h12,14H,3-11H2,1-2H3 |
| InChIKey | DHCFXIUWOAWZKB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |